C18H16N4O2S — CID 35272257
2-[4-(4-carbamoylphenyl)anilino]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 35272257) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-[4-(4-carbamoylphenyl)anilino]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(4-carbamoylphenyl)anilino]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 35272257 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[4-(4-carbamoylphenyl)anilino]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(Nc2ccc(-c3ccc(C(N)=O)cc3)cc2)n1 |
| InChI | InChI=1S/C18H16N4O2S/c1-20-17(24)15-10-25-18(22-15)21-14-8-6-12(7-9-14)11-2-4-13(5-3-11)16(19)23/h2-10H,1H3,(H2,19,23)(H,20,24)(H,21,22) |
| InChIKey | DYYQJZDUSHOBJT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |