C11H17NOS2 — CID 3528313
(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)carbamodithioic acid (PubChem CID 3528313) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is (4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)carbamodithioic acid.
| Compound Name | (4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)carbamodithioic acid |
|---|---|
| PubChem CID | 3528313 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)carbamodithioic acid |
| SMILES | CC12CCC(C(NC(=S)S)C1=O)C2(C)C |
| InChI | InChI=1S/C11H17NOS2/c1-10(2)6-4-5-11(10,3)8(13)7(6)12-9(14)15/h6-7H,4-5H2,1-3H3,(H2,12,14,15) |
| InChIKey | TYGIKKCTXUVYPS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|