C29H31Cl2N3O2 — CID 3533471
[2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3533471) has the molecular formula C29H31Cl2N3O2 and a molecular weight of 524.49 g/mol. Its IUPAC name is [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3533471 |
| Molecular Formula | C29H31Cl2N3O2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1ccn2c(NC(C)(C)CC(C)(C)C)c(-c3ccccc3OC(=O)c3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C29H31Cl2N3O2/c1-18-13-14-34-24(15-18)32-25(26(34)33-29(5,6)17-28(2,3)4)21-9-7-8-10-23(21)36-27(35)20-12-11-19(30)16-22(20)31/h7-16,33H,17H2,1-6H3 |
| InChIKey | QTIITSZIMOEQST-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|