C21H16N2O6 — CID 35337837
N-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-4-oxochromene-2-carboxamide (PubChem CID 35337837) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35337837 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-4-oxochromene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(NC(=O)c3cc(=O)c4ccccc4o3)on2)cc1OC |
| InChI | InChI=1S/C21H16N2O6/c1-26-17-8-7-12(9-18(17)27-2)14-10-20(29-23-14)22-21(25)19-11-15(24)13-5-3-4-6-16(13)28-19/h3-11H,1-2H3,(H,22,25) |
| InChIKey | LIQVEXJVWXRIJA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |