C23H18FNO6S — CID 35346351
N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 35346351) has the molecular formula C23H18FNO6S and a molecular weight of 455.46 g/mol. Its IUPAC name is N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 35346351 |
| Molecular Formula | C23H18FNO6S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2c(C(=O)c3ccc(F)cc3)oc3ccccc23)c1 |
| InChI | InChI=1S/C23H18FNO6S/c1-29-16-11-12-19(30-2)20(13-16)32(27,28)25-21-17-5-3-4-6-18(17)31-23(21)22(26)14-7-9-15(24)10-8-14/h3-13,25H,1-2H3 |
| InChIKey | ASJDUMXILBRHSO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |