C22H30N2O5S2 — CID 35366410
N-(2-butoxy-5-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 35366410) has the molecular formula C22H30N2O5S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-(2-butoxy-5-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-(2-butoxy-5-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 35366410 |
| Molecular Formula | C22H30N2O5S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(2-butoxy-5-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C22H30N2O5S2/c1-3-4-14-29-20-10-8-17(28-2)15-19(20)23-21(25)16-18-9-11-22(30-18)31(26,27)24-12-6-5-7-13-24/h8-11,15H,3-7,12-14,16H2,1-2H3,(H,23,25) |
| InChIKey | FQMXKNFOXHCZJS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|