C21H28N4O4S — CID 35388303
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]pentanamide (PubChem CID 35388303) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 35388303 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]pentanamide |
| SMILES | COc1ccc(NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1N1CCCC1=O |
| InChI | InChI=1S/C21H28N4O4S/c1-29-16-9-8-13(11-15(16)25-10-4-7-19(25)27)22-18(26)6-3-2-5-17-20-14(12-30-17)23-21(28)24-20/h8-9,11,14,17,20H,2-7,10,12H2,1H3,(H,22,26)(H2,23,24,28)/t14-,17-,20-/m0/s1 |
| InChIKey | QISNGVVRORPBDK-VHFSOBRXSA-N |
| XLogP | 2.49 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|