C17H24N2O3 — CID 3539182
2-[2,2-dimethoxyethyl(methyl)amino]-1-(2,6-dimethyl-1H-indol-3-yl)ethanone (PubChem CID 3539182) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[2,2-dimethoxyethyl(methyl)amino]-1-(2,6-dimethyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-[2,2-dimethoxyethyl(methyl)amino]-1-(2,6-dimethyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 3539182 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-[2,2-dimethoxyethyl(methyl)amino]-1-(2,6-dimethyl-1H-indol-3-yl)ethanone |
| SMILES | COC(CN(C)CC(=O)c1c(C)[nH]c2cc(C)ccc12)OC |
| InChI | InChI=1S/C17H24N2O3/c1-11-6-7-13-14(8-11)18-12(2)17(13)15(20)9-19(3)10-16(21-4)22-5/h6-8,16,18H,9-10H2,1-5H3 |
| InChIKey | JZOXHLIFEVMMGI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|