C17H20IN3OS — CID 44668194
1-(2,6-dimethyl-1H-indol-3-yl)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethanone;hydroiodide (PubChem CID 44668194) has the molecular formula C17H20IN3OS and a molecular weight of 441.34 g/mol. Its IUPAC name is 1-(2,6-dimethyl-1H-indol-3-yl)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethanone;hydroiodide.
| Compound Name | 1-(2,6-dimethyl-1H-indol-3-yl)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethanone;hydroiodide |
|---|---|
| PubChem CID | 44668194 |
| Molecular Formula | C17H20IN3OS |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 1-(2,6-dimethyl-1H-indol-3-yl)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethanone;hydroiodide |
| SMILES | Cc1ccc2c(C(=O)CNc3nc(C)c(C)s3)c(C)[nH]c2c1.I |
| InChI | InChI=1S/C17H19N3OS.HI/c1-9-5-6-13-14(7-9)19-11(3)16(13)15(21)8-18-17-20-10(2)12(4)22-17;/h5-7,19H,8H2,1-4H3,(H,18,20);1H |
| InChIKey | BFPVFLAFDSSOHH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|