C27H25ClN4O5 — CID 3542941
N-(2-chloro-5-nitrophenyl)-14-cyclohexyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 3542941) has the molecular formula C27H25ClN4O5 and a molecular weight of 520.97 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-14-cyclohexyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-14-cyclohexyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 3542941 |
| Molecular Formula | C27H25ClN4O5 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-14-cyclohexyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C1C2C(=O)N(C3CCCCC3)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H25ClN4O5/c28-19-11-10-17(32(36)37)14-20(19)29-25(33)24-22-21(23-18-9-5-4-6-15(18)12-13-30(23)24)26(34)31(27(22)35)16-7-2-1-3-8-16/h4-6,9-14,16,21-24H,1-3,7-8H2,(H,29,33) |
| InChIKey | ODMPTMZAVMUCBV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|