C28H26N2O5 — CID 124768581
(1R,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-cyclohexyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 124768581) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is (1R,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-cyclohexyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-cyclohexyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 124768581 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (1R,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-cyclohexyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc2c(c1)OCO2)[C@@H]1[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C28H26N2O5/c31-26(17-10-11-20-21(14-17)35-15-34-20)25-23-22(24-19-9-5-4-6-16(19)12-13-29(24)25)27(32)30(28(23)33)18-7-2-1-3-8-18/h4-6,9-14,18,22-25H,1-3,7-8,15H2/t22-,23-,24+,25+/m1/s1 |
| InChIKey | XDTVKLGGNGEFCO-NGSHPTGOSA-N |
| XLogP | 3.94 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|