C26H28Cl2FN3O4 — CID 3547229
2-[(2,6-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 3547229) has the molecular formula C26H28Cl2FN3O4 and a molecular weight of 536.43 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3547229 |
| Molecular Formula | C26H28Cl2FN3O4 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H28Cl2FN3O4/c1-2-35-14-5-13-31(26(34)30-25-22(27)7-3-8-23(25)28)18-24(33)32(17-21-6-4-15-36-21)16-19-9-11-20(29)12-10-19/h3-4,6-12,15H,2,5,13-14,16-18H2,1H3,(H,30,34) |
| InChIKey | FTZVUAJDXLUTFI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|