C27H32FN3O5 — CID 4193760
2-[3-ethoxypropyl-[(4-methoxyphenyl)carbamoyl]amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 4193760) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is 2-[3-ethoxypropyl-[(4-methoxyphenyl)carbamoyl]amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-ethoxypropyl-[(4-methoxyphenyl)carbamoyl]amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4193760 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[3-ethoxypropyl-[(4-methoxyphenyl)carbamoyl]amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H32FN3O5/c1-3-35-16-5-15-30(27(33)29-23-11-13-24(34-2)14-12-23)20-26(32)31(19-25-6-4-17-36-25)18-21-7-9-22(28)10-8-21/h4,6-14,17H,3,5,15-16,18-20H2,1-2H3,(H,29,33) |
| InChIKey | ZRVIADFQQDVDFC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|