C27H31FN2O5S — CID 5098727
2-[3-ethoxypropyl(2-phenylethenylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 5098727) has the molecular formula C27H31FN2O5S and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-[3-ethoxypropyl(2-phenylethenylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-ethoxypropyl(2-phenylethenylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5098727 |
| Molecular Formula | C27H31FN2O5S |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[3-ethoxypropyl(2-phenylethenylsulfonyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1)S(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C27H31FN2O5S/c1-2-34-17-7-16-30(36(32,33)19-15-23-8-4-3-5-9-23)22-27(31)29(21-26-10-6-18-35-26)20-24-11-13-25(28)14-12-24/h3-6,8-15,18-19H,2,7,16-17,20-22H2,1H3 |
| InChIKey | ZXCSTZOOUUEVFC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|