C21H21NO3S — CID 1058730
N-(furan-2-ylmethyl)-2-phenyl-N-(2-phenylethyl)ethenesulfonamide (PubChem CID 1058730) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-phenyl-N-(2-phenylethyl)ethenesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-2-phenyl-N-(2-phenylethyl)ethenesulfonamide |
|---|---|
| PubChem CID | 1058730 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-phenyl-N-(2-phenylethyl)ethenesulfonamide |
| SMILES | O=S(=O)(C=Cc1ccccc1)N(CCc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C21H21NO3S/c23-26(24,17-14-20-10-5-2-6-11-20)22(18-21-12-7-16-25-21)15-13-19-8-3-1-4-9-19/h1-12,14,16-17H,13,15,18H2 |
| InChIKey | BGZNBKYVBQDALE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |