C21H26N4O3S — CID 3547605
3,5-dimethoxy-N-[[2-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3547605) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[[2-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[[2-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3547605 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3,5-dimethoxy-N-[[2-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2ccccc2N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C21H26N4O3S/c1-24-8-10-25(11-9-24)19-7-5-4-6-18(19)22-21(29)23-20(26)15-12-16(27-2)14-17(13-15)28-3/h4-7,12-14H,8-11H2,1-3H3,(H2,22,23,26,29) |
| InChIKey | WUGOTFPMZBCIEZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|