C14H18N4O2 — CID 3551068
N-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 3551068) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 3551068 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCNC(=O)c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C14H18N4O2/c1-14(2,3)10-4-6-11(7-5-10)20-9-16-13(19)12-15-8-17-18-12/h4-8H,9H2,1-3H3,(H,16,19)(H,15,17,18) |
| InChIKey | JTVFQVAXHPJAEX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|