C16H13F3N5O+ — CID 3552617
N-phenyl-2-[5-[3-(trifluoromethyl)phenyl]-2H-tetrazol-3-ium-3-yl]acetamide (PubChem CID 3552617) has the molecular formula C16H13F3N5O+ and a molecular weight of 348.31 g/mol. Its IUPAC name is N-phenyl-2-[5-[3-(trifluoromethyl)phenyl]-2H-tetrazol-3-ium-3-yl]acetamide.
| Compound Name | N-phenyl-2-[5-[3-(trifluoromethyl)phenyl]-2H-tetrazol-3-ium-3-yl]acetamide |
|---|---|
| PubChem CID | 3552617 |
| Molecular Formula | C16H13F3N5O+ |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-phenyl-2-[5-[3-(trifluoromethyl)phenyl]-2H-tetrazol-3-ium-3-yl]acetamide |
| SMILES | O=C(C[n+]1nc(-c2cccc(C(F)(F)F)c2)n[nH]1)Nc1ccccc1 |
| InChI | InChI=1S/C16H12F3N5O/c17-16(18,19)12-6-4-5-11(9-12)15-21-23-24(22-15)10-14(25)20-13-7-2-1-3-8-13/h1-9H,10H2,(H,20,25)/p+1 |
| InChIKey | DIALSFXVMTZHSI-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|