About [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate
[2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate (PubChem CID 3554241) has the molecular formula C19H15BrN2O4S
and a molecular weight of 447.31 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate |
| PubChem CID | 3554241 |
| Molecular Formula | C19H15BrN2O4S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(Nc2nc(C(=O)OCC(=O)c3ccc(Br)cc3)cs2)cc1 |
| InChI | InChI=1S/C19H15BrN2O4S/c1-25-15-8-6-14(7-9-15)21-19-22-16(11-27-19)18(24)26-10-17(23)12-2-4-13(20)5-3-12/h2-9,11H,10H2,1H3,(H,21,22) |
| InChIKey | FITPQNHCBSUASA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate?
The IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate (CID 3554241) is [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate is COc1ccc(Nc2nc(C(=O)OCC(=O)c3ccc(Br)cc3)cs2)cc1.
What is the InChIKey of [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate?
The InChIKey is FITPQNHCBSUASA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN2O4S/c1-25-15-8-6-14(7-9-15)21-19-22-16(11-27-19)18(24)26-10-17(23)12-2-4-13(20)5-3-12/h2-9,11H,10H2,1H3,(H,21,22).
What are the key properties of [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate?
[2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate has a molecular weight of 447.31 g/mol, XLogP of 4.70, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-oxoethyl] 2-(4-methoxyanilino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 3554241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).