C17H22N2O4S2 — CID 35569450
N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 35569450) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 35569450 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[(1S,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N[C@H]2CCCC[C@H]2N2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-11-7-8-12(2)15(9-11)25(22,23)18-13-5-3-4-6-14(13)19-16(20)10-24-17(19)21/h7-9,13-14,18H,3-6,10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | OZTSQXINHYAZJV-UONOGXRCSA-N |
| XLogP | 2.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|