C17H22N2O4S2 — CID 35569452
N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-ethylbenzenesulfonamide (PubChem CID 35569452) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 35569452 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2N2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-2-12-7-9-13(10-8-12)25(22,23)18-14-5-3-4-6-15(14)19-16(20)11-24-17(19)21/h7-10,14-15,18H,2-6,11H2,1H3/t14-,15+/m1/s1 |
| InChIKey | FFVIJWHISBSCPU-CABCVRRESA-N |
| XLogP | 2.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|