C16H23N7O3 — CID 3558870
2-[[2-(5-aminotetrazol-1-yl)acetyl]-methylamino]-N-(4-methoxyphenyl)-2-methylbutanamide (PubChem CID 3558870) has the molecular formula C16H23N7O3 and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-[[2-(5-aminotetrazol-1-yl)acetyl]-methylamino]-N-(4-methoxyphenyl)-2-methylbutanamide.
| Compound Name | 2-[[2-(5-aminotetrazol-1-yl)acetyl]-methylamino]-N-(4-methoxyphenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 3558870 |
| Molecular Formula | C16H23N7O3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-[[2-(5-aminotetrazol-1-yl)acetyl]-methylamino]-N-(4-methoxyphenyl)-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc(OC)cc1)N(C)C(=O)Cn1nnnc1N |
| InChI | InChI=1S/C16H23N7O3/c1-5-16(2,14(25)18-11-6-8-12(26-4)9-7-11)22(3)13(24)10-23-15(17)19-20-21-23/h6-9H,5,10H2,1-4H3,(H,18,25)(H2,17,19,21) |
| InChIKey | XTRACISFIYRKBX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |