C13H11Cl2N3O — CID 3562027
N'-[(2,6-dichlorophenyl)methoxy]pyridine-2-carboximidamide (PubChem CID 3562027) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is N'-[(2,6-dichlorophenyl)methoxy]pyridine-2-carboximidamide.
| Compound Name | N'-[(2,6-dichlorophenyl)methoxy]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 3562027 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N'-[(2,6-dichlorophenyl)methoxy]pyridine-2-carboximidamide |
| SMILES | NC(=NOCc1c(Cl)cccc1Cl)c1ccccn1 |
| InChI | InChI=1S/C13H11Cl2N3O/c14-10-4-3-5-11(15)9(10)8-19-18-13(16)12-6-1-2-7-17-12/h1-7H,8H2,(H2,16,18) |
| InChIKey | NHODROUMNDBPDW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|