C30H28N2O6 — CID 3567197
2,3-bis[[(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione (PubChem CID 3567197) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 2,3-bis[[(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione.
| Compound Name | 2,3-bis[[(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 3567197 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2,3-bis[[(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione |
| SMILES | CC1=CC(=NOC2=C(ON=C3C=C(C)C(=O)C=C3C(C)C)C(=O)c3ccccc3C2=O)C(C(C)C)=CC1=O |
| InChI | InChI=1S/C30H28N2O6/c1-15(2)21-13-25(33)17(5)11-23(21)31-37-29-27(35)19-9-7-8-10-20(19)28(36)30(29)38-32-24-12-18(6)26(34)14-22(24)16(3)4/h7-16H,1-6H3 |
| InChIKey | GCRLNLUVLAOFFT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|