C17H19ClN4O4S — CID 3567850
2-chloro-N-(3-methylbutyl)-4-nitro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide (PubChem CID 3567850) has the molecular formula C17H19ClN4O4S and a molecular weight of 410.88 g/mol. Its IUPAC name is 2-chloro-N-(3-methylbutyl)-4-nitro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide.
| Compound Name | 2-chloro-N-(3-methylbutyl)-4-nitro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3567850 |
| Molecular Formula | C17H19ClN4O4S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-chloro-N-(3-methylbutyl)-4-nitro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)CCN(CC(=O)Nc1nccs1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H19ClN4O4S/c1-11(2)5-7-21(10-15(23)20-17-19-6-8-27-17)16(24)13-4-3-12(22(25)26)9-14(13)18/h3-4,6,8-9,11H,5,7,10H2,1-2H3,(H,19,20,23) |
| InChIKey | NKEUBSLCVOUALJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|