C18H18N2O2S — CID 3568687
4,6-bis(4-methoxyphenyl)-6H-1,3-thiazin-2-amine (PubChem CID 3568687) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4,6-bis(4-methoxyphenyl)-6H-1,3-thiazin-2-amine.
| Compound Name | 4,6-bis(4-methoxyphenyl)-6H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 3568687 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4,6-bis(4-methoxyphenyl)-6H-1,3-thiazin-2-amine |
| SMILES | COc1ccc(C2=CC(c3ccc(OC)cc3)SC(N)=N2)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-21-14-7-3-12(4-8-14)16-11-17(23-18(19)20-16)13-5-9-15(22-2)10-6-13/h3-11,17H,1-2H3,(H2,19,20) |
| InChIKey | AQHKADGWDSGNBJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |