C19H27N3O6S — CID 3570098
ethyl 3-[[2-(3,4,5-trimethoxybenzoyl)pyrazolidine-1-carbothioyl]amino]propanoate (PubChem CID 3570098) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is ethyl 3-[[2-(3,4,5-trimethoxybenzoyl)pyrazolidine-1-carbothioyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(3,4,5-trimethoxybenzoyl)pyrazolidine-1-carbothioyl]amino]propanoate |
|---|---|
| PubChem CID | 3570098 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 3-[[2-(3,4,5-trimethoxybenzoyl)pyrazolidine-1-carbothioyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=S)N1CCCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H27N3O6S/c1-5-28-16(23)7-8-20-19(29)22-10-6-9-21(22)18(24)13-11-14(25-2)17(27-4)15(12-13)26-3/h11-12H,5-10H2,1-4H3,(H,20,29) |
| InChIKey | WDKMTHFQKDCXOZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|