C24H35N3O4S — CID 3840814
N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(3,4,5-trimethoxyphenyl)propanoyl]pyrazolidine-1-carbothioamide (PubChem CID 3840814) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(3,4,5-trimethoxyphenyl)propanoyl]pyrazolidine-1-carbothioamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(3,4,5-trimethoxyphenyl)propanoyl]pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3840814 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(3,4,5-trimethoxyphenyl)propanoyl]pyrazolidine-1-carbothioamide |
| SMILES | COc1cc(CCC(=O)N2CCCN2C(=S)NCCC2=CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H35N3O4S/c1-29-20-16-19(17-21(30-2)23(20)31-3)10-11-22(28)26-14-7-15-27(26)24(32)25-13-12-18-8-5-4-6-9-18/h8,16-17H,4-7,9-15H2,1-3H3,(H,25,32) |
| InChIKey | GWWNGSZAKALKBS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|