C17H27N3O3S — CID 3851914
methyl 4-[2-[2-(cyclohexen-1-yl)ethylcarbamothioyl]pyrazolidin-1-yl]-4-oxobutanoate (PubChem CID 3851914) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is methyl 4-[2-[2-(cyclohexen-1-yl)ethylcarbamothioyl]pyrazolidin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[2-[2-(cyclohexen-1-yl)ethylcarbamothioyl]pyrazolidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 3851914 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | methyl 4-[2-[2-(cyclohexen-1-yl)ethylcarbamothioyl]pyrazolidin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCCN1C(=S)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H27N3O3S/c1-23-16(22)9-8-15(21)19-12-5-13-20(19)17(24)18-11-10-14-6-3-2-4-7-14/h6H,2-5,7-13H2,1H3,(H,18,24) |
| InChIKey | JVEVDTPOEXWASQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|