C21H23N3O4S — CID 3573998
N-[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide (PubChem CID 3573998) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide.
| Compound Name | N-[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3573998 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)N1CCC(N2C(=O)OCC2Cc2ccccc2)CC1)c1ccco1 |
| InChI | InChI=1S/C21H23N3O4S/c25-19(18-7-4-12-27-18)22-20(29)23-10-8-16(9-11-23)24-17(14-28-21(24)26)13-15-5-2-1-3-6-15/h1-7,12,16-17H,8-11,13-14H2,(H,22,25,29) |
| InChIKey | ZRFNEOJYVQOHGW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|