C18H22N2O4 — CID 3857415
ethenyl 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carboxylate (PubChem CID 3857415) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethenyl 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carboxylate.
| Compound Name | ethenyl 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3857415 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethenyl 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carboxylate |
| SMILES | C=COC(=O)N1CCC(N2C(=O)OCC2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N2O4/c1-2-23-17(21)19-10-8-15(9-11-19)20-16(13-24-18(20)22)12-14-6-4-3-5-7-14/h2-7,15-16H,1,8-13H2 |
| InChIKey | DIZCVMGZLQFLHY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|