C19H25N3O4S — CID 3697585
methyl 2-[[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]acetate (PubChem CID 3697585) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is methyl 2-[[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]acetate.
| Compound Name | methyl 2-[[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]acetate |
|---|---|
| PubChem CID | 3697585 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | methyl 2-[[4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]acetate |
| SMILES | COC(=O)CNC(=S)N1CCC(N2C(=O)OCC2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N3O4S/c1-25-17(23)12-20-18(27)21-9-7-15(8-10-21)22-16(13-26-19(22)24)11-14-5-3-2-4-6-14/h2-6,15-16H,7-13H2,1H3,(H,20,27) |
| InChIKey | VHKOORGKDMIXME-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|