C18H25N3O4S — CID 3831963
N-[4-(4-butyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide (PubChem CID 3831963) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[4-(4-butyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide.
| Compound Name | N-[4-(4-butyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3831963 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[4-(4-butyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]furan-2-carboxamide |
| SMILES | CCCCC1COC(=O)N1C1CCN(C(=S)NC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H25N3O4S/c1-2-3-5-14-12-25-18(23)21(14)13-7-9-20(10-8-13)17(26)19-16(22)15-6-4-11-24-15/h4,6,11,13-14H,2-3,5,7-10,12H2,1H3,(H,19,22,26) |
| InChIKey | SFLATTZUMJXHMG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|