C20H29N3O2S2 — CID 4994095
4-(4-butan-2-yl-2-oxo-1,3-oxazolidin-3-yl)-N-(2-methylsulfanylphenyl)piperidine-1-carbothioamide (PubChem CID 4994095) has the molecular formula C20H29N3O2S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is 4-(4-butan-2-yl-2-oxo-1,3-oxazolidin-3-yl)-N-(2-methylsulfanylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-(4-butan-2-yl-2-oxo-1,3-oxazolidin-3-yl)-N-(2-methylsulfanylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 4994095 |
| Molecular Formula | C20H29N3O2S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-(4-butan-2-yl-2-oxo-1,3-oxazolidin-3-yl)-N-(2-methylsulfanylphenyl)piperidine-1-carbothioamide |
| SMILES | CCC(C)C1COC(=O)N1C1CCN(C(=S)Nc2ccccc2SC)CC1 |
| InChI | InChI=1S/C20H29N3O2S2/c1-4-14(2)17-13-25-20(24)23(17)15-9-11-22(12-10-15)19(26)21-16-7-5-6-8-18(16)27-3/h5-8,14-15,17H,4,9-13H2,1-3H3,(H,21,26) |
| InChIKey | JLAXJTZXEQUSIF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|