C18H13N3O3S — CID 35752706
(2R)-2-[5-(3-nitrophenyl)thiophen-2-yl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 35752706) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is (2R)-2-[5-(3-nitrophenyl)thiophen-2-yl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2R)-2-[5-(3-nitrophenyl)thiophen-2-yl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 35752706 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (2R)-2-[5-(3-nitrophenyl)thiophen-2-yl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1N[C@H](c2ccc(-c3cccc([N+](=O)[O-])c3)s2)Nc2ccccc21 |
| InChI | InChI=1S/C18H13N3O3S/c22-18-13-6-1-2-7-14(13)19-17(20-18)16-9-8-15(25-16)11-4-3-5-12(10-11)21(23)24/h1-10,17,19H,(H,20,22)/t17-/m1/s1 |
| InChIKey | ZHSFHKXWPHFPIZ-QGZVFWFLSA-N |
| XLogP | 4.18 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|