C17H15BrClN3O — CID 35754615
N-[1-(4-bromophenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-2-chlorobenzamide (PubChem CID 35754615) has the molecular formula C17H15BrClN3O and a molecular weight of 392.68 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-2-chlorobenzamide.
| Compound Name | N-[1-(4-bromophenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 35754615 |
| Molecular Formula | C17H15BrClN3O |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-[1-(4-bromophenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-2-chlorobenzamide |
| SMILES | O=C(NC1=NCCCN1c1ccc(Br)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C17H15BrClN3O/c18-12-6-8-13(9-7-12)22-11-3-10-20-17(22)21-16(23)14-4-1-2-5-15(14)19/h1-2,4-9H,3,10-11H2,(H,20,21,23) |
| InChIKey | GHTFNKDICSVGHF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |