C26H25Cl2N3O2 — CID 3589769
N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethylbenzamide (PubChem CID 3589769) has the molecular formula C26H25Cl2N3O2 and a molecular weight of 482.41 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 3589769 |
| Molecular Formula | C26H25Cl2N3O2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)c4ccc(Cl)cc4)CC3)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C26H25Cl2N3O2/c1-17-3-9-22(18(2)15-17)25(32)29-21-8-10-24(23(28)16-21)30-11-13-31(14-12-30)26(33)19-4-6-20(27)7-5-19/h3-10,15-16H,11-14H2,1-2H3,(H,29,32) |
| InChIKey | UAYFACWZVBCVOO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|