C25H19N3O6S — CID 3589880
[1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-nitrobenzenesulfonate (PubChem CID 3589880) has the molecular formula C25H19N3O6S and a molecular weight of 489.51 g/mol. Its IUPAC name is [1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-nitrobenzenesulfonate.
| Compound Name | [1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3589880 |
| Molecular Formula | C25H19N3O6S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | [1-[[(4-methylbenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(C(=O)NN=Cc2c(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H19N3O6S/c1-17-9-11-19(12-10-17)25(29)27-26-16-23-22-8-3-2-5-18(22)13-14-24(23)34-35(32,33)21-7-4-6-20(15-21)28(30)31/h2-16H,1H3,(H,27,29) |
| InChIKey | MHGIPPSTXYPHTH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|