C24H18N4O6S — CID 3258149
[1-[[(4-aminobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate (PubChem CID 3258149) has the molecular formula C24H18N4O6S and a molecular weight of 490.50 g/mol. Its IUPAC name is [1-[[(4-aminobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate.
| Compound Name | [1-[[(4-aminobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3258149 |
| Molecular Formula | C24H18N4O6S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [1-[[(4-aminobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
| SMILES | Nc1ccc(C(=O)NN=Cc2c(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H18N4O6S/c25-18-8-5-17(6-9-18)24(29)27-26-15-22-21-4-2-1-3-16(21)7-14-23(22)34-35(32,33)20-12-10-19(11-13-20)28(30)31/h1-15H,25H2,(H,27,29) |
| InChIKey | OFSHQVKTPCEUEK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|