C25H25FN2O6 — CID 3596301
ethyl 4-[3-[1-ethoxy-3-(4-fluoroanilino)-1-oxobut-2-en-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 3596301) has the molecular formula C25H25FN2O6 and a molecular weight of 468.48 g/mol. Its IUPAC name is ethyl 4-[3-[1-ethoxy-3-(4-fluoroanilino)-1-oxobut-2-en-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[1-ethoxy-3-(4-fluoroanilino)-1-oxobut-2-en-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3596301 |
| Molecular Formula | C25H25FN2O6 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | ethyl 4-[3-[1-ethoxy-3-(4-fluoroanilino)-1-oxobut-2-en-2-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)C(=C(C)Nc1ccc(F)cc1)C1CC(=O)N(c2ccc(C(=O)OCC)cc2)C1=O |
| InChI | InChI=1S/C25H25FN2O6/c1-4-33-24(31)16-6-12-19(13-7-16)28-21(29)14-20(23(28)30)22(25(32)34-5-2)15(3)27-18-10-8-17(26)9-11-18/h6-13,20,27H,4-5,14H2,1-3H3 |
| InChIKey | ZUOYVLVUXIFKFP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|