C27H36N2O7S — CID 3596739
ethyl 2,5-dimethyl-4-[[8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decan-2-yl]sulfonyl]furan-3-carboxylate (PubChem CID 3596739) has the molecular formula C27H36N2O7S and a molecular weight of 532.66 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-4-[[8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decan-2-yl]sulfonyl]furan-3-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-4-[[8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decan-2-yl]sulfonyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 3596739 |
| Molecular Formula | C27H36N2O7S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | ethyl 2,5-dimethyl-4-[[8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decan-2-yl]sulfonyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(C)c1S(=O)(=O)N1CCC2(CCN(C(=O)CCCOc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C27H36N2O7S/c1-4-34-26(31)24-20(2)36-21(3)25(24)37(32,33)29-17-14-27(19-29)12-15-28(16-13-27)23(30)11-8-18-35-22-9-6-5-7-10-22/h5-7,9-10H,4,8,11-19H2,1-3H3 |
| InChIKey | UGVQOFGLKSHVAF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|