C20H12F13NO4 — CID 3598493
4-methoxy-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]benzamide (PubChem CID 3598493) has the molecular formula C20H12F13NO4 and a molecular weight of 577.29 g/mol. Its IUPAC name is 4-methoxy-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3598493 |
| Molecular Formula | C20H12F13NO4 |
| Molecular Weight | 577.29 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | 4-methoxy-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H12F13NO4/c1-36-13-7-5-10(6-8-13)14(35)34-12-4-2-3-11(9-12)15(21,22)17(25,26)37-18(27,28)16(23,24)19(29,30)38-20(31,32)33/h2-9H,1H3,(H,34,35) |
| InChIKey | AKDHBQZPJMDRIT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.29 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|