C22H15F13N2O3S — CID 21172207
3,5-dimethyl-N-[[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]carbamothioyl]benzamide (PubChem CID 21172207) has the molecular formula C22H15F13N2O3S and a molecular weight of 634.41 g/mol. Its IUPAC name is 3,5-dimethyl-N-[[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21172207 |
| Molecular Formula | C22H15F13N2O3S |
| Molecular Weight | 634.41 g/mol |
| Exact Mass | 634.06 |
| IUPAC Name | 3,5-dimethyl-N-[[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)Nc2cccc(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H15F13N2O3S/c1-10-6-11(2)8-12(7-10)15(38)37-16(41)36-14-5-3-4-13(9-14)17(23,24)19(27,28)39-20(29,30)18(25,26)21(31,32)40-22(33,34)35/h3-9H,1-2H3,(H2,36,37,38,41) |
| InChIKey | QTLNAXASCKYNCN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.41 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|