C23H11BrF13NO4 — CID 4500752
5-(4-bromophenyl)-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]furan-2-carboxamide (PubChem CID 4500752) has the molecular formula C23H11BrF13NO4 and a molecular weight of 692.22 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4500752 |
| Molecular Formula | C23H11BrF13NO4 |
| Molecular Weight | 692.22 g/mol |
| Exact Mass | 690.97 |
| IUPAC Name | 5-(4-bromophenyl)-N-[3-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)c1)c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C23H11BrF13NO4/c24-13-6-4-11(5-7-13)15-8-9-16(40-15)17(39)38-14-3-1-2-12(10-14)18(25,26)20(29,30)41-21(31,32)19(27,28)22(33,34)42-23(35,36)37/h1-10H,(H,38,39) |
| InChIKey | HVZQRGJXENMDIH-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.22 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|