C12H16Cl2N4OS — CID 3598503
2,2-dichloro-N-(3-imidazol-1-ylpropylcarbamothioyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 3598503) has the molecular formula C12H16Cl2N4OS and a molecular weight of 335.26 g/mol. Its IUPAC name is 2,2-dichloro-N-(3-imidazol-1-ylpropylcarbamothioyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(3-imidazol-1-ylpropylcarbamothioyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3598503 |
| Molecular Formula | C12H16Cl2N4OS |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2,2-dichloro-N-(3-imidazol-1-ylpropylcarbamothioyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NC(=S)NCCCn2ccnc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H16Cl2N4OS/c1-11(7-12(11,13)14)9(19)17-10(20)16-3-2-5-18-6-4-15-8-18/h4,6,8H,2-3,5,7H2,1H3,(H2,16,17,19,20) |
| InChIKey | MYPMYIUTEQXIPQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|