C17H15N3O4 — CID 3598619
5-(3,4-dimethoxyphenyl)-N-pyridin-3-yl-1,2-oxazole-3-carboxamide (PubChem CID 3598619) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-pyridin-3-yl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-pyridin-3-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 3598619 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-pyridin-3-yl-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3cccnc3)no2)cc1OC |
| InChI | InChI=1S/C17H15N3O4/c1-22-14-6-5-11(8-16(14)23-2)15-9-13(20-24-15)17(21)19-12-4-3-7-18-10-12/h3-10H,1-2H3,(H,19,21) |
| InChIKey | UAIKQYGGEYNLIZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |