C33H37N3O7 — CID 3599416
(4,5-dimethoxy-2-nitrophenyl)methyl 4-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 3599416) has the molecular formula C33H37N3O7 and a molecular weight of 587.67 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methyl 4-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methyl 4-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3599416 |
| Molecular Formula | C33H37N3O7 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methyl 4-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | COc1cc(COC(=O)N2CCC(C3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C33H37N3O7/c1-41-30-20-28(29(36(39)40)21-31(30)42-2)22-43-33(38)35-18-14-26(15-19-35)25-12-16-34(17-13-25)32(37)27-10-8-24(9-11-27)23-6-4-3-5-7-23/h3-11,20-21,25-26H,12-19,22H2,1-2H3 |
| InChIKey | CTBXMHVAUZVZHR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|