C27H26N2O10 — CID 102075977
5-O-[dideuterio-(2-nitro-4-phenylphenyl)methyl] 1-O-[(4,5-dimethoxy-2-nitrophenyl)methyl] pentanedioate (PubChem CID 102075977) has the molecular formula C27H26N2O10 and a molecular weight of 540.52 g/mol. Its IUPAC name is 5-O-[dideuterio-(2-nitro-4-phenylphenyl)methyl] 1-O-[(4,5-dimethoxy-2-nitrophenyl)methyl] pentanedioate.
| Compound Name | 5-O-[dideuterio-(2-nitro-4-phenylphenyl)methyl] 1-O-[(4,5-dimethoxy-2-nitrophenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 102075977 |
| Molecular Formula | C27H26N2O10 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 5-O-[dideuterio-(2-nitro-4-phenylphenyl)methyl] 1-O-[(4,5-dimethoxy-2-nitrophenyl)methyl] pentanedioate |
| SMILES | [2H]C([2H])(OC(=O)CCCC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-])c1ccc(-c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H26N2O10/c1-36-24-14-21(23(29(34)35)15-25(24)37-2)17-39-27(31)10-6-9-26(30)38-16-20-12-11-19(13-22(20)28(32)33)18-7-4-3-5-8-18/h3-5,7-8,11-15H,6,9-10,16-17H2,1-2H3/i16D2 |
| InChIKey | RSSHZBMZLNJQNZ-BPPAMHLBSA-N |
| XLogP | 5.14 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|