C25H20N2O2S2 — CID 3607896
2-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-5-propoxyphenol (PubChem CID 3607896) has the molecular formula C25H20N2O2S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-5-propoxyphenol.
| Compound Name | 2-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-5-propoxyphenol |
|---|---|
| PubChem CID | 3607896 |
| Molecular Formula | C25H20N2O2S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-5-propoxyphenol |
| SMILES | CCCOc1ccc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C25H20N2O2S2/c1-2-13-29-17-12-11-16(21(28)15-17)14-18(24-26-19-7-3-5-9-22(19)30-24)25-27-20-8-4-6-10-23(20)31-25/h3-12,14-15,28H,2,13H2,1H3 |
| InChIKey | VUCJQXVBILVOKK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |