C18H16F3N5O3 — CID 3608369
6,6-dimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 3608369) has the molecular formula C18H16F3N5O3 and a molecular weight of 407.35 g/mol. Its IUPAC name is 6,6-dimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 6,6-dimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 3608369 |
| Molecular Formula | C18H16F3N5O3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 6,6-dimethyl-9-(4-nitrophenyl)-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(C(F)(F)F)nn1C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16F3N5O3/c1-17(2)7-11-13(12(27)8-17)14(9-3-5-10(6-4-9)26(28)29)25-16(22-11)23-15(24-25)18(19,20)21/h3-6,14H,7-8H2,1-2H3,(H,22,23,24) |
| InChIKey | XPUWWSBENOQRNJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|